C18H14F4N2O7S2 — CID 87539422
[2-(4-fluorophenyl)-6-(methanesulfonamido)-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate (PubChem CID 87539422) has the molecular formula C18H14F4N2O7S2 and a molecular weight of 510.44 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-6-(methanesulfonamido)-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate.
| Compound Name | [2-(4-fluorophenyl)-6-(methanesulfonamido)-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87539422 |
| Molecular Formula | C18H14F4N2O7S2 |
| Molecular Weight | 510.44 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | [2-(4-fluorophenyl)-6-(methanesulfonamido)-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(NS(C)(=O)=O)c(OS(=O)(=O)C(F)(F)F)cc12 |
| InChI | InChI=1S/C18H14F4N2O7S2/c1-23-17(25)15-11-7-14(31-33(28,29)18(20,21)22)12(24-32(2,26)27)8-13(11)30-16(15)9-3-5-10(19)6-4-9/h3-8,24H,1-2H3,(H,23,25) |
| InChIKey | GLRNTBGTDHRJJW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|