C17H16BFN2O4 — CID 144679662
[2-(4-fluorophenyl)-6-(methylamino)-3-(methylcarbamoyl)-1-benzofuran-5-yl]boronic acid (PubChem CID 144679662) has the molecular formula C17H16BFN2O4 and a molecular weight of 342.14 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-6-(methylamino)-3-(methylcarbamoyl)-1-benzofuran-5-yl]boronic acid.
| Compound Name | [2-(4-fluorophenyl)-6-(methylamino)-3-(methylcarbamoyl)-1-benzofuran-5-yl]boronic acid |
|---|---|
| PubChem CID | 144679662 |
| Molecular Formula | C17H16BFN2O4 |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [2-(4-fluorophenyl)-6-(methylamino)-3-(methylcarbamoyl)-1-benzofuran-5-yl]boronic acid |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(NC)c(B(O)O)cc12 |
| InChI | InChI=1S/C17H16BFN2O4/c1-20-13-8-14-11(7-12(13)18(23)24)15(17(22)21-2)16(25-14)9-3-5-10(19)6-4-9/h3-8,20,23-24H,1-2H3,(H,21,22) |
| InChIKey | KKZMMEQVOTXJFL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|