C23H15F2NO4 — CID 59275666
2-fluoro-4-[2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]benzoic acid (PubChem CID 59275666) has the molecular formula C23H15F2NO4 and a molecular weight of 407.37 g/mol. Its IUPAC name is 2-fluoro-4-[2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]benzoic acid.
| Compound Name | 2-fluoro-4-[2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]benzoic acid |
|---|---|
| PubChem CID | 59275666 |
| Molecular Formula | C23H15F2NO4 |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-fluoro-4-[2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]benzoic acid |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2ccc(-c3ccc(C(=O)O)c(F)c3)cc12 |
| InChI | InChI=1S/C23H15F2NO4/c1-26-22(27)20-17-10-13(14-4-8-16(23(28)29)18(25)11-14)5-9-19(17)30-21(20)12-2-6-15(24)7-3-12/h2-11H,1H3,(H,26,27)(H,28,29) |
| InChIKey | FUWSUDUTTPYAGS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |