C23H17FN2O4 — CID 143956974
3-amino-5-[2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]benzoic acid (PubChem CID 143956974) has the molecular formula C23H17FN2O4 and a molecular weight of 404.40 g/mol. Its IUPAC name is 3-amino-5-[2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]benzoic acid.
| Compound Name | 3-amino-5-[2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]benzoic acid |
|---|---|
| PubChem CID | 143956974 |
| Molecular Formula | C23H17FN2O4 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 3-amino-5-[2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]benzoic acid |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2ccc(-c3cc(N)cc(C(=O)O)c3)cc12 |
| InChI | InChI=1S/C23H17FN2O4/c1-26-22(27)20-18-11-13(14-8-15(23(28)29)10-17(25)9-14)4-7-19(18)30-21(20)12-2-5-16(24)6-3-12/h2-11H,25H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | VZGAPWSNRHVHSD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|