C22H23BFNO4 — CID 59275475
2-(4-fluorophenyl)-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carboxamide (PubChem CID 59275475) has the molecular formula C22H23BFNO4 and a molecular weight of 395.24 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 59275475 |
| Molecular Formula | C22H23BFNO4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-(4-fluorophenyl)-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2ccc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C22H23BFNO4/c1-21(2)22(3,4)29-23(28-21)14-8-11-17-16(12-14)18(20(26)25-5)19(27-17)13-6-9-15(24)10-7-13/h6-12H,1-5H3,(H,25,26) |
| InChIKey | PXJGFPDYXKRNAY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|