C32H33BF2N2O6S — CID 71258701
5-cyclopropyl-2-(4-fluorophenyl)-6-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylsulfonylamino]-N-methyl-1-benzofuran-3-carboxamide (PubChem CID 71258701) has the molecular formula C32H33BF2N2O6S and a molecular weight of 622.50 g/mol. Its IUPAC name is 5-cyclopropyl-2-(4-fluorophenyl)-6-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylsulfonylamino]-N-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 5-cyclopropyl-2-(4-fluorophenyl)-6-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylsulfonylamino]-N-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 71258701 |
| Molecular Formula | C32H33BF2N2O6S |
| Molecular Weight | 622.50 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | 5-cyclopropyl-2-(4-fluorophenyl)-6-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylsulfonylamino]-N-methyl-1-benzofuran-3-carboxamide |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CS(=O)(=O)NC3=C(C=C4C(=C3)OC(=C4C(=O)NC)C5=CC=C(C=C5)F)C6CC6)F |
| InChI | InChI=1S/C32H33BF2N2O6S/c1-31(2)32(3,4)43-33(42-31)21-11-8-20(25(35)14-21)17-44(39,40)37-26-16-27-24(15-23(26)18-6-7-18)28(30(38)36-5)29(41-27)19-9-12-22(34)13-10-19/h8-16,18,37H,6-7,17H2,1-5H3,(H,36,38) |
| InChIKey | OPMBIXACOHXRBZ-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 115.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | 1140 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|