C24H27FN2O6S — CID 134263235
5-cyclopropyl-2-(4-fluorophenyl)-6-[3-(2-hydroxyethoxy)propylsulfonylamino]-N-methyl-1-benzofuran-3-carboxamide (PubChem CID 134263235) has the molecular formula C24H27FN2O6S and a molecular weight of 490.55 g/mol. Its IUPAC name is 5-cyclopropyl-2-(4-fluorophenyl)-6-[3-(2-hydroxyethoxy)propylsulfonylamino]-N-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 5-cyclopropyl-2-(4-fluorophenyl)-6-[3-(2-hydroxyethoxy)propylsulfonylamino]-N-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 134263235 |
| Molecular Formula | C24H27FN2O6S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 5-cyclopropyl-2-(4-fluorophenyl)-6-[3-(2-hydroxyethoxy)propylsulfonylamino]-N-methyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(NS(=O)(=O)CCCOCCO)c(C3CC3)cc12 |
| InChI | InChI=1S/C24H27FN2O6S/c1-26-24(29)22-19-13-18(15-3-4-15)20(27-34(30,31)12-2-10-32-11-9-28)14-21(19)33-23(22)16-5-7-17(25)8-6-16/h5-8,13-15,27-28H,2-4,9-12H2,1H3,(H,26,29) |
| InChIKey | YIFWSRIETZZGLZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|