C30H37FN2O7S — CID 139298299
5-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]methylsulfonylamino]pentoxy]pentanoic acid (PubChem CID 139298299) has the molecular formula C30H37FN2O7S and a molecular weight of 588.70 g/mol. Its IUPAC name is 5-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]methylsulfonylamino]pentoxy]pentanoic acid.
| Compound Name | 5-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]methylsulfonylamino]pentoxy]pentanoic acid |
|---|---|
| PubChem CID | 139298299 |
| Molecular Formula | C30H37FN2O7S |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | 5-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]methylsulfonylamino]pentoxy]pentanoic acid |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(CS(=O)(=O)NCCCCCOCCCCC(=O)O)c(C3CC3)cc12 |
| InChI | InChI=1S/C30H37FN2O7S/c1-32-30(36)28-25-18-24(20-8-9-20)22(17-26(25)40-29(28)21-10-12-23(31)13-11-21)19-41(37,38)33-14-4-2-5-15-39-16-6-3-7-27(34)35/h10-13,17-18,20,33H,2-9,14-16,19H2,1H3,(H,32,36)(H,34,35) |
| InChIKey | NIXBMAVVMQNBKB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|