C32H33FN2O5 — CID 139322862
4-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]amino]pentoxymethyl]benzoic acid (PubChem CID 139322862) has the molecular formula C32H33FN2O5 and a molecular weight of 544.62 g/mol. Its IUPAC name is 4-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]amino]pentoxymethyl]benzoic acid.
| Compound Name | 4-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]amino]pentoxymethyl]benzoic acid |
|---|---|
| PubChem CID | 139322862 |
| Molecular Formula | C32H33FN2O5 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 4-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]amino]pentoxymethyl]benzoic acid |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(NCCCCCOCc3ccc(C(=O)O)cc3)c(C3CC3)cc12 |
| InChI | InChI=1S/C32H33FN2O5/c1-34-31(36)29-26-17-25(21-9-10-21)27(18-28(26)40-30(29)22-11-13-24(33)14-12-22)35-15-3-2-4-16-39-19-20-5-7-23(8-6-20)32(37)38/h5-8,11-14,17-18,21,35H,2-4,9-10,15-16,19H2,1H3,(H,34,36)(H,37,38) |
| InChIKey | BUHBCWJXVRCZCS-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|