C33H38FN3O6S2 — CID 145160794
2-amino-4-[2-[2-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfanylamino]ethoxy]ethoxymethyl]benzoic acid;methanethiol (PubChem CID 145160794) has the molecular formula C33H38FN3O6S2 and a molecular weight of 655.81 g/mol. Its IUPAC name is 2-amino-4-[2-[2-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfanylamino]ethoxy]ethoxymethyl]benzoic acid;methanethiol.
| Compound Name | 2-amino-4-[2-[2-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfanylamino]ethoxy]ethoxymethyl]benzoic acid;methanethiol |
|---|---|
| PubChem CID | 145160794 |
| Molecular Formula | C33H38FN3O6S2 |
| Molecular Weight | 655.81 g/mol |
| Exact Mass | 655.22 |
| IUPAC Name | 2-amino-4-[2-[2-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfanylamino]ethoxy]ethoxymethyl]benzoic acid;methanethiol |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(CCOCCOCc3ccc(C(=O)O)c(N)c3)SC)c(C3CC3)cc12.CS |
| InChI | InChI=1S/C32H34FN3O6S.CH4S/c1-35-31(37)29-25-16-24(20-4-5-20)27(17-28(25)42-30(29)21-6-8-22(33)9-7-21)36(43-2)11-12-40-13-14-41-18-19-3-10-23(32(38)39)26(34)15-19;1-2/h3,6-10,15-17,20H,4-5,11-14,18,34H2,1-2H3,(H,35,37)(H,38,39);2H,1H3 |
| InChIKey | MLNDUOAKCVBKAT-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.81 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|