C34H37FN2O7S — CID 139322878
4-[2-[2-[2-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfanylamino]ethoxy]ethoxy]ethoxymethyl]benzoic acid (PubChem CID 139322878) has the molecular formula C34H37FN2O7S and a molecular weight of 636.74 g/mol. Its IUPAC name is 4-[2-[2-[2-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfanylamino]ethoxy]ethoxy]ethoxymethyl]benzoic acid.
| Compound Name | 4-[2-[2-[2-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfanylamino]ethoxy]ethoxy]ethoxymethyl]benzoic acid |
|---|---|
| PubChem CID | 139322878 |
| Molecular Formula | C34H37FN2O7S |
| Molecular Weight | 636.74 g/mol |
| Exact Mass | 636.23 |
| IUPAC Name | 4-[2-[2-[2-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfanylamino]ethoxy]ethoxy]ethoxymethyl]benzoic acid |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(CCOCCOCCOCc3ccc(C(=O)O)cc3)SC)c(C3CC3)cc12 |
| InChI | InChI=1S/C34H37FN2O7S/c1-36-33(38)31-28-19-27(23-7-8-23)29(20-30(28)44-32(31)24-9-11-26(35)12-10-24)37(45-2)13-14-41-15-16-42-17-18-43-21-22-3-5-25(6-4-22)34(39)40/h3-6,9-12,19-20,23H,7-8,13-18,21H2,1-2H3,(H,36,38)(H,39,40) |
| InChIKey | WJUOUNWPXLYHLO-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 110.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.74 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|