C33H29FN2O5S — CID 71258616
5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-6-[(4-phenylmethoxyphenyl)methyl-sulfinoamino]-1-benzofuran (PubChem CID 71258616) has the molecular formula C33H29FN2O5S and a molecular weight of 584.67 g/mol. Its IUPAC name is 5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-6-[(4-phenylmethoxyphenyl)methyl-sulfinoamino]-1-benzofuran.
| Compound Name | 5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-6-[(4-phenylmethoxyphenyl)methyl-sulfinoamino]-1-benzofuran |
|---|---|
| PubChem CID | 71258616 |
| Molecular Formula | C33H29FN2O5S |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-6-[(4-phenylmethoxyphenyl)methyl-sulfinoamino]-1-benzofuran |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(Cc3ccc(OCc4ccccc4)cc3)S(=O)O)c(C3CC3)cc12 |
| InChI | InChI=1S/C33H29FN2O5S/c1-35-33(37)31-28-17-27(23-9-10-23)29(18-30(28)41-32(31)24-11-13-25(34)14-12-24)36(42(38)39)19-21-7-15-26(16-8-21)40-20-22-5-3-2-4-6-22/h2-8,11-18,23H,9-10,19-20H2,1H3,(H,35,37)(H,38,39) |
| InChIKey | LMIVBBXEXVMARQ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|