C26H22ClFN3O4S- — CID 86696008
6-[(4-amino-3-chlorophenyl)methyl-sulfinatoamino]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran (PubChem CID 86696008) has the molecular formula C26H22ClFN3O4S- and a molecular weight of 527.00 g/mol. Its IUPAC name is 6-[(4-amino-3-chlorophenyl)methyl-sulfinatoamino]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran.
| Compound Name | 6-[(4-amino-3-chlorophenyl)methyl-sulfinatoamino]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran |
|---|---|
| PubChem CID | 86696008 |
| Molecular Formula | C26H22ClFN3O4S- |
| Molecular Weight | 527.00 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 6-[(4-amino-3-chlorophenyl)methyl-sulfinatoamino]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(Cc3ccc(N)c(Cl)c3)S(=O)[O-])c(C3CC3)cc12 |
| InChI | InChI=1S/C26H23ClFN3O4S/c1-30-26(32)24-19-11-18(15-3-4-15)22(12-23(19)35-25(24)16-5-7-17(28)8-6-16)31(36(33)34)13-14-2-9-21(29)20(27)10-14/h2,5-12,15H,3-4,13,29H2,1H3,(H,30,32)(H,33,34)/p-1 |
| InChIKey | FBPYLXZOTLFVOZ-UHFFFAOYSA-M |
| XLogP | 5.51 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.00 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|