C28H26BClFN2O6S- — CID 67352490
6-[[2-(4-borono-3-chlorophenyl)ethyl-sulfinatoamino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran (PubChem CID 67352490) has the molecular formula C28H26BClFN2O6S- and a molecular weight of 583.85 g/mol. Its IUPAC name is 6-[[2-(4-borono-3-chlorophenyl)ethyl-sulfinatoamino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran.
| Compound Name | 6-[[2-(4-borono-3-chlorophenyl)ethyl-sulfinatoamino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran |
|---|---|
| PubChem CID | 67352490 |
| Molecular Formula | C28H26BClFN2O6S- |
| Molecular Weight | 583.85 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | 6-[[2-(4-borono-3-chlorophenyl)ethyl-sulfinatoamino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(CN(CCc3ccc(B(O)O)c(Cl)c3)S(=O)[O-])c(C3CC3)cc12 |
| InChI | InChI=1S/C28H27BClFN2O6S/c1-32-28(34)26-22-14-21(17-3-4-17)19(13-25(22)39-27(26)18-5-7-20(31)8-6-18)15-33(40(37)38)11-10-16-2-9-23(29(35)36)24(30)12-16/h2,5-9,12-14,17,35-36H,3-4,10-11,15H2,1H3,(H,32,34)(H,37,38)/p-1 |
| InChIKey | DNHPUWSDWGYQKX-UHFFFAOYSA-M |
| XLogP | 3.65 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.85 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|