C28H27BClFN2O6S — CID 89407483
6-[[4-(2-borono-2-chloroethyl)-N-sulfinoanilino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran (PubChem CID 89407483) has the molecular formula C28H27BClFN2O6S and a molecular weight of 584.86 g/mol. Its IUPAC name is 6-[[4-(2-borono-2-chloroethyl)-N-sulfinoanilino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran.
| Compound Name | 6-[[4-(2-borono-2-chloroethyl)-N-sulfinoanilino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran |
|---|---|
| PubChem CID | 89407483 |
| Molecular Formula | C28H27BClFN2O6S |
| Molecular Weight | 584.86 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | 6-[[4-(2-borono-2-chloroethyl)-N-sulfinoanilino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(CN(c3ccc(CC(Cl)B(O)O)cc3)S(=O)O)c(C3CC3)cc12 |
| InChI | InChI=1S/C28H27BClFN2O6S/c1-32-28(34)26-23-14-22(17-4-5-17)19(13-24(23)39-27(26)18-6-8-20(31)9-7-18)15-33(40(37)38)21-10-2-16(3-11-21)12-25(30)29(35)36/h2-3,6-11,13-14,17,25,35-36H,4-5,12,15H2,1H3,(H,32,34)(H,37,38) |
| InChIKey | PCLXJDIUIGLJNP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.86 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|