C27H24F3N3O4S — CID 86696017
6-[[4-amino-3-(difluoromethyl)phenyl]methyl-sulfinoamino]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran (PubChem CID 86696017) has the molecular formula C27H24F3N3O4S and a molecular weight of 543.57 g/mol. Its IUPAC name is 6-[[4-amino-3-(difluoromethyl)phenyl]methyl-sulfinoamino]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran.
| Compound Name | 6-[[4-amino-3-(difluoromethyl)phenyl]methyl-sulfinoamino]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran |
|---|---|
| PubChem CID | 86696017 |
| Molecular Formula | C27H24F3N3O4S |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 6-[[4-amino-3-(difluoromethyl)phenyl]methyl-sulfinoamino]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(Cc3ccc(N)c(C(F)F)c3)S(=O)O)c(C3CC3)cc12 |
| InChI | InChI=1S/C27H24F3N3O4S/c1-32-27(34)24-20-11-18(15-3-4-15)22(12-23(20)37-25(24)16-5-7-17(28)8-6-16)33(38(35)36)13-14-2-9-21(31)19(10-14)26(29)30/h2,5-12,15,26H,3-4,13,31H2,1H3,(H,32,34)(H,35,36) |
| InChIKey | CJXBITJXWHJOJX-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|