C27H23BFN2O6S- — CID 71258611
5-[[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-sulfinatoamino]methyl]-1-hydroxy-3H-2,1-benzoxaborole (PubChem CID 71258611) has the molecular formula C27H23BFN2O6S- and a molecular weight of 533.37 g/mol. Its IUPAC name is 5-[[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-sulfinatoamino]methyl]-1-hydroxy-3H-2,1-benzoxaborole.
| Compound Name | 5-[[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-sulfinatoamino]methyl]-1-hydroxy-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 71258611 |
| Molecular Formula | C27H23BFN2O6S- |
| Molecular Weight | 533.37 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | 5-[[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-sulfinatoamino]methyl]-1-hydroxy-3H-2,1-benzoxaborole |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(Cc3ccc4c(c3)COB4O)S(=O)[O-])c(C3CC3)cc12 |
| InChI | InChI=1S/C27H24BFN2O6S/c1-30-27(32)25-21-11-20(16-3-4-16)23(12-24(21)37-26(25)17-5-7-19(29)8-6-17)31(38(34)35)13-15-2-9-22-18(10-15)14-36-28(22)33/h2,5-12,16,33H,3-4,13-14H2,1H3,(H,30,32)(H,34,35)/p-1 |
| InChIKey | MNWABSQFWSDTHR-UHFFFAOYSA-M |
| XLogP | 3.49 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|