C31H33BFN3O6S — CID 71258828
2-[[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-sulfinoamino]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 71258828) has the molecular formula C31H33BFN3O6S and a molecular weight of 605.50 g/mol. Its IUPAC name is 2-[[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-sulfinoamino]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-[[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-sulfinoamino]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 71258828 |
| Molecular Formula | C31H33BFN3O6S |
| Molecular Weight | 605.50 g/mol |
| Exact Mass | 605.22 |
| IUPAC Name | 2-[[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-sulfinoamino]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(Cc3ccc(B4OC(C)(C)C(C)(C)O4)cn3)S(=O)O)c(C3CC3)cc12 |
| InChI | InChI=1S/C31H33BFN3O6S/c1-30(2)31(3,4)42-32(41-30)20-10-13-22(35-16-20)17-36(43(38)39)25-15-26-24(14-23(25)18-6-7-18)27(29(37)34-5)28(40-26)19-8-11-21(33)12-9-19/h8-16,18H,6-7,17H2,1-5H3,(H,34,37)(H,38,39) |
| InChIKey | RLMJUTJIXJQNPN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 114.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|