C27H23BClFN2O6S — CID 71258540
7-chloro-5-[[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-sulfinoamino]methyl]-1-hydroxy-3H-2,1-benzoxaborole (PubChem CID 71258540) has the molecular formula C27H23BClFN2O6S and a molecular weight of 568.82 g/mol. Its IUPAC name is 7-chloro-5-[[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-sulfinoamino]methyl]-1-hydroxy-3H-2,1-benzoxaborole.
| Compound Name | 7-chloro-5-[[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-sulfinoamino]methyl]-1-hydroxy-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 71258540 |
| Molecular Formula | C27H23BClFN2O6S |
| Molecular Weight | 568.82 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | 7-chloro-5-[[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-sulfinoamino]methyl]-1-hydroxy-3H-2,1-benzoxaborole |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(Cc3cc(Cl)c4c(c3)COB4O)S(=O)O)c(C3CC3)cc12 |
| InChI | InChI=1S/C27H23BClFN2O6S/c1-31-27(33)24-20-10-19(15-2-3-15)22(11-23(20)38-26(24)16-4-6-18(30)7-5-16)32(39(35)36)12-14-8-17-13-37-28(34)25(17)21(29)9-14/h4-11,15,34H,2-3,12-13H2,1H3,(H,31,33)(H,35,36) |
| InChIKey | NTYPQOQJIFPTJS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.82 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|