C26H20F2N3O6S- — CID 71258762
5-cyclopropyl-6-[(3-fluoro-4-nitrophenyl)methyl-sulfinatoamino]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran (PubChem CID 71258762) has the molecular formula C26H20F2N3O6S- and a molecular weight of 540.52 g/mol. Its IUPAC name is 5-cyclopropyl-6-[(3-fluoro-4-nitrophenyl)methyl-sulfinatoamino]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran.
| Compound Name | 5-cyclopropyl-6-[(3-fluoro-4-nitrophenyl)methyl-sulfinatoamino]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran |
|---|---|
| PubChem CID | 71258762 |
| Molecular Formula | C26H20F2N3O6S- |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | 5-cyclopropyl-6-[(3-fluoro-4-nitrophenyl)methyl-sulfinatoamino]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(Cc3ccc([N+](=O)[O-])c(F)c3)S(=O)[O-])c(C3CC3)cc12 |
| InChI | InChI=1S/C26H21F2N3O6S/c1-29-26(32)24-19-11-18(15-3-4-15)22(12-23(19)37-25(24)16-5-7-17(27)8-6-16)30(38(35)36)13-14-2-9-21(31(33)34)20(28)10-14/h2,5-12,15H,3-4,13H2,1H3,(H,29,32)(H,35,36)/p-1 |
| InChIKey | HQMJHESYMSAZCZ-UHFFFAOYSA-M |
| XLogP | 5.32 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|