C26H21ClFN3O6S — CID 131732254
6-(3-chloro-N-methylsulfonyl-4-nitroanilino)-5-cyclopropyl-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide (PubChem CID 131732254) has the molecular formula C26H21ClFN3O6S and a molecular weight of 557.99 g/mol. Its IUPAC name is 6-(3-chloro-N-methylsulfonyl-4-nitroanilino)-5-cyclopropyl-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 6-(3-chloro-N-methylsulfonyl-4-nitroanilino)-5-cyclopropyl-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 131732254 |
| Molecular Formula | C26H21ClFN3O6S |
| Molecular Weight | 557.99 g/mol |
| Exact Mass | 557.08 |
| IUPAC Name | 6-(3-chloro-N-methylsulfonyl-4-nitroanilino)-5-cyclopropyl-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(c3ccc([N+](=O)[O-])c(Cl)c3)S(C)(=O)=O)c(C3CC3)cc12 |
| InChI | InChI=1S/C26H21ClFN3O6S/c1-29-26(32)24-19-12-18(14-3-4-14)22(13-23(19)37-25(24)15-5-7-16(28)8-6-15)30(38(2,35)36)17-9-10-21(31(33)34)20(27)11-17/h5-14H,3-4H2,1-2H3,(H,29,32) |
| InChIKey | LBICOAGGZYXLHP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.99 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|