C27H24FN3O6S — CID 71258768
5-cyclopropyl-2-(4-fluorophenyl)-N-methyl-6-[(3-methyl-4-nitrophenyl)methylsulfonylamino]-1-benzofuran-3-carboxamide (PubChem CID 71258768) has the molecular formula C27H24FN3O6S and a molecular weight of 537.57 g/mol. Its IUPAC name is 5-cyclopropyl-2-(4-fluorophenyl)-N-methyl-6-[(3-methyl-4-nitrophenyl)methylsulfonylamino]-1-benzofuran-3-carboxamide.
| Compound Name | 5-cyclopropyl-2-(4-fluorophenyl)-N-methyl-6-[(3-methyl-4-nitrophenyl)methylsulfonylamino]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 71258768 |
| Molecular Formula | C27H24FN3O6S |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 5-cyclopropyl-2-(4-fluorophenyl)-N-methyl-6-[(3-methyl-4-nitrophenyl)methylsulfonylamino]-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(NS(=O)(=O)Cc3ccc([N+](=O)[O-])c(C)c3)c(C3CC3)cc12 |
| InChI | InChI=1S/C27H24FN3O6S/c1-15-11-16(3-10-23(15)31(33)34)14-38(35,36)30-22-13-24-21(12-20(22)17-4-5-17)25(27(32)29-2)26(37-24)18-6-8-19(28)9-7-18/h3,6-13,17,30H,4-5,14H2,1-2H3,(H,29,32) |
| InChIKey | GUAIRAPHXWCVAF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|