C28H23F2N3O8S — CID 71258696
methyl 5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]methylsulfonylamino]-3-fluoro-2-nitrobenzoate (PubChem CID 71258696) has the molecular formula C28H23F2N3O8S and a molecular weight of 599.57 g/mol. Its IUPAC name is methyl 5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]methylsulfonylamino]-3-fluoro-2-nitrobenzoate.
| Compound Name | methyl 5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]methylsulfonylamino]-3-fluoro-2-nitrobenzoate |
|---|---|
| PubChem CID | 71258696 |
| Molecular Formula | C28H23F2N3O8S |
| Molecular Weight | 599.57 g/mol |
| Exact Mass | 599.12 |
| IUPAC Name | methyl 5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]methylsulfonylamino]-3-fluoro-2-nitrobenzoate |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(CS(=O)(=O)Nc3cc(F)c([N+](=O)[O-])c(C(=O)OC)c3)c(C3CC3)cc12 |
| InChI | InChI=1S/C28H23F2N3O8S/c1-31-27(34)24-20-12-19(14-3-4-14)16(9-23(20)41-26(24)15-5-7-17(29)8-6-15)13-42(38,39)32-18-10-21(28(35)40-2)25(33(36)37)22(30)11-18/h5-12,14,32H,3-4,13H2,1-2H3,(H,31,34) |
| InChIKey | IOPBALSZTYFBGE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 157.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|