C29H26FN3O8S — CID 71258760
methyl 2-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfonylamino]-2-nitrophenyl]acetate (PubChem CID 71258760) has the molecular formula C29H26FN3O8S and a molecular weight of 595.61 g/mol. Its IUPAC name is methyl 2-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfonylamino]-2-nitrophenyl]acetate.
| Compound Name | methyl 2-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfonylamino]-2-nitrophenyl]acetate |
|---|---|
| PubChem CID | 71258760 |
| Molecular Formula | C29H26FN3O8S |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | methyl 2-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfonylamino]-2-nitrophenyl]acetate |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(c3ccc([N+](=O)[O-])c(CC(=O)OC)c3)S(C)(=O)=O)c(C3CC3)cc12 |
| InChI | InChI=1S/C29H26FN3O8S/c1-31-29(35)27-22-14-21(16-4-5-16)24(15-25(22)41-28(27)17-6-8-19(30)9-7-17)32(42(3,38)39)20-10-11-23(33(36)37)18(12-20)13-26(34)40-2/h6-12,14-16H,4-5,13H2,1-3H3,(H,31,35) |
| InChIKey | UWNLINFRPQVNMK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 149.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|