C29H28FN3O6S — CID 86696059
6-[[4-amino-3-(2-methoxy-2-oxoethyl)-N-sulfinoanilino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran (PubChem CID 86696059) has the molecular formula C29H28FN3O6S and a molecular weight of 565.62 g/mol. Its IUPAC name is 6-[[4-amino-3-(2-methoxy-2-oxoethyl)-N-sulfinoanilino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran.
| Compound Name | 6-[[4-amino-3-(2-methoxy-2-oxoethyl)-N-sulfinoanilino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran |
|---|---|
| PubChem CID | 86696059 |
| Molecular Formula | C29H28FN3O6S |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | 6-[[4-amino-3-(2-methoxy-2-oxoethyl)-N-sulfinoanilino]methyl]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(CN(c3ccc(N)c(CC(=O)OC)c3)S(=O)O)c(C3CC3)cc12 |
| InChI | InChI=1S/C29H28FN3O6S/c1-32-29(35)27-23-14-22(16-3-4-16)19(12-25(23)39-28(27)17-5-7-20(30)8-6-17)15-33(40(36)37)21-9-10-24(31)18(11-21)13-26(34)38-2/h5-12,14,16H,3-4,13,15,31H2,1-2H3,(H,32,35)(H,36,37) |
| InChIKey | PTNVAHUGNBLQBU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|