C28H28FN3O5S — CID 86696061
6-[[4-amino-3-(2-hydroxyethyl)phenyl]methyl-sulfinoamino]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran (PubChem CID 86696061) has the molecular formula C28H28FN3O5S and a molecular weight of 537.61 g/mol. Its IUPAC name is 6-[[4-amino-3-(2-hydroxyethyl)phenyl]methyl-sulfinoamino]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran.
| Compound Name | 6-[[4-amino-3-(2-hydroxyethyl)phenyl]methyl-sulfinoamino]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran |
|---|---|
| PubChem CID | 86696061 |
| Molecular Formula | C28H28FN3O5S |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 6-[[4-amino-3-(2-hydroxyethyl)phenyl]methyl-sulfinoamino]-5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(Cc3ccc(N)c(CCO)c3)S(=O)O)c(C3CC3)cc12 |
| InChI | InChI=1S/C28H28FN3O5S/c1-31-28(34)26-22-13-21(17-3-4-17)24(14-25(22)37-27(26)18-5-7-20(29)8-6-18)32(38(35)36)15-16-2-9-23(30)19(12-16)10-11-33/h2,5-9,12-14,17,33H,3-4,10-11,15,30H2,1H3,(H,31,34)(H,35,36) |
| InChIKey | PJVFENWFOKWITI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|