C26H23BCl2N2O6S — CID 71258735
6-[(4-borono-3-chloro-N-sulfinoanilino)methyl]-2-(4-chlorophenyl)-5-cyclopropyl-3-(methylcarbamoyl)-1-benzofuran (PubChem CID 71258735) has the molecular formula C26H23BCl2N2O6S and a molecular weight of 573.26 g/mol. Its IUPAC name is 6-[(4-borono-3-chloro-N-sulfinoanilino)methyl]-2-(4-chlorophenyl)-5-cyclopropyl-3-(methylcarbamoyl)-1-benzofuran.
| Compound Name | 6-[(4-borono-3-chloro-N-sulfinoanilino)methyl]-2-(4-chlorophenyl)-5-cyclopropyl-3-(methylcarbamoyl)-1-benzofuran |
|---|---|
| PubChem CID | 71258735 |
| Molecular Formula | C26H23BCl2N2O6S |
| Molecular Weight | 573.26 g/mol |
| Exact Mass | 572.07 |
| IUPAC Name | 6-[(4-borono-3-chloro-N-sulfinoanilino)methyl]-2-(4-chlorophenyl)-5-cyclopropyl-3-(methylcarbamoyl)-1-benzofuran |
| SMILES | CNC(=O)c1c(-c2ccc(Cl)cc2)oc2cc(CN(c3ccc(B(O)O)c(Cl)c3)S(=O)O)c(C3CC3)cc12 |
| InChI | InChI=1S/C26H23BCl2N2O6S/c1-30-26(32)24-20-12-19(14-2-3-14)16(10-23(20)37-25(24)15-4-6-17(28)7-5-15)13-31(38(35)36)18-8-9-21(27(33)34)22(29)11-18/h4-12,14,33-34H,2-3,13H2,1H3,(H,30,32)(H,35,36) |
| InChIKey | KFXQUZASAVDQLP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.26 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|