C26H21ClFN2O5S- — CID 71258431
2-(4-chlorophenyl)-5-cyclopropyl-6-[(3-fluoro-4-hydroxyphenyl)methyl-sulfinatoamino]-3-(methylcarbamoyl)-1-benzofuran (PubChem CID 71258431) has the molecular formula C26H21ClFN2O5S- and a molecular weight of 527.98 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-cyclopropyl-6-[(3-fluoro-4-hydroxyphenyl)methyl-sulfinatoamino]-3-(methylcarbamoyl)-1-benzofuran.
| Compound Name | 2-(4-chlorophenyl)-5-cyclopropyl-6-[(3-fluoro-4-hydroxyphenyl)methyl-sulfinatoamino]-3-(methylcarbamoyl)-1-benzofuran |
|---|---|
| PubChem CID | 71258431 |
| Molecular Formula | C26H21ClFN2O5S- |
| Molecular Weight | 527.98 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | 2-(4-chlorophenyl)-5-cyclopropyl-6-[(3-fluoro-4-hydroxyphenyl)methyl-sulfinatoamino]-3-(methylcarbamoyl)-1-benzofuran |
| SMILES | CNC(=O)c1c(-c2ccc(Cl)cc2)oc2cc(N(Cc3ccc(O)c(F)c3)S(=O)[O-])c(C3CC3)cc12 |
| InChI | InChI=1S/C26H22ClFN2O5S/c1-29-26(32)24-19-11-18(15-3-4-15)21(12-23(19)35-25(24)16-5-7-17(27)8-6-16)30(36(33)34)13-14-2-9-22(31)20(28)10-14/h2,5-12,15,31H,3-4,13H2,1H3,(H,29,32)(H,33,34)/p-1 |
| InChIKey | YVIZGDODWXWBJT-UHFFFAOYSA-M |
| XLogP | 5.64 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.98 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|