C19H16ClNO6S — CID 174716724
2-(4-chlorophenyl)-5-cyclopropyl-6-[methyl(sulfinooxy)amino]-1-benzofuran-3-carboxylic acid (PubChem CID 174716724) has the molecular formula C19H16ClNO6S and a molecular weight of 421.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-cyclopropyl-6-[methyl(sulfinooxy)amino]-1-benzofuran-3-carboxylic acid.
| Compound Name | 2-(4-chlorophenyl)-5-cyclopropyl-6-[methyl(sulfinooxy)amino]-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 174716724 |
| Molecular Formula | C19H16ClNO6S |
| Molecular Weight | 421.86 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 2-(4-chlorophenyl)-5-cyclopropyl-6-[methyl(sulfinooxy)amino]-1-benzofuran-3-carboxylic acid |
| SMILES | CN(OS(=O)O)c1cc2oc(-c3ccc(Cl)cc3)c(C(=O)O)c2cc1C1CC1 |
| InChI | InChI=1S/C19H16ClNO6S/c1-21(27-28(24)25)15-9-16-14(8-13(15)10-2-3-10)17(19(22)23)18(26-16)11-4-6-12(20)7-5-11/h4-10H,2-3H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | PUPTUGLXGPHIRT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.86 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|