C34H35BClF3N2O6S — CID 67352752
2-(4-chlorophenyl)-5-cyclopropyl-N-methyl-6-[methylsulfonyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]methyl]amino]-1-benzofuran-3-carboxamide (PubChem CID 67352752) has the molecular formula C34H35BClF3N2O6S and a molecular weight of 702.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-cyclopropyl-N-methyl-6-[methylsulfonyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]methyl]amino]-1-benzofuran-3-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-5-cyclopropyl-N-methyl-6-[methylsulfonyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]methyl]amino]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 67352752 |
| Molecular Formula | C34H35BClF3N2O6S |
| Molecular Weight | 702.99 g/mol |
| Exact Mass | 702.19 |
| IUPAC Name | 2-(4-chlorophenyl)-5-cyclopropyl-N-methyl-6-[methylsulfonyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenyl]methyl]amino]-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(Cl)cc2)oc2cc(N(Cc3ccc(B4OC(C)(C)C(C)(C)O4)c(C(F)(F)F)c3)S(C)(=O)=O)c(C3CC3)cc12 |
| InChI | InChI=1S/C34H35BClF3N2O6S/c1-32(2)33(3,4)47-35(46-32)26-14-7-19(15-25(26)34(37,38)39)18-41(48(6,43)44)27-17-28-24(16-23(27)20-8-9-20)29(31(42)40-5)30(45-28)21-10-12-22(36)13-11-21/h7,10-17,20H,8-9,18H2,1-6H3,(H,40,42) |
| InChIKey | NGODRHYGGGSYQH-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.99 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|