C35H38BFN2O8S — CID 154122251
5-[1-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfonylamino]ethyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (PubChem CID 154122251) has the molecular formula C35H38BFN2O8S and a molecular weight of 676.57 g/mol. Its IUPAC name is 5-[1-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfonylamino]ethyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid.
| Compound Name | 5-[1-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfonylamino]ethyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 154122251 |
| Molecular Formula | C35H38BFN2O8S |
| Molecular Weight | 676.57 g/mol |
| Exact Mass | 676.24 |
| IUPAC Name | 5-[1-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfonylamino]ethyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C(C)c3ccc(B4OC(C)(C)C(C)(C)O4)c(C(=O)O)c3)S(C)(=O)=O)c(C3CC3)cc12 |
| InChI | InChI=1S/C35H38BFN2O8S/c1-19(22-12-15-27(25(16-22)33(41)42)36-46-34(2,3)35(4,5)47-36)39(48(7,43)44)28-18-29-26(17-24(28)20-8-9-20)30(32(40)38-6)31(45-29)21-10-13-23(37)14-11-21/h10-20H,8-9H2,1-7H3,(H,38,40)(H,41,42) |
| InChIKey | MTZZZKVQWWOMHN-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|