C26H21BF2N2O4S — CID 150737539
CID 150737539 (PubChem CID 150737539) has the molecular formula C26H21BF2N2O4S and a molecular weight of 506.34 g/mol.
| Compound Name | CID 150737539 |
|---|---|
| PubChem CID | 150737539 |
| Molecular Formula | C26H21BF2N2O4S |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N(c2cc3oc(-c4ccc(F)cc4)c(C(=O)NC)c3cc2C2CC2)S(C)(=O)=O)cc1F |
| InChI | InChI=1S/C26H21BF2N2O4S/c1-30-26(32)24-19-12-18(14-3-4-14)22(13-23(19)35-25(24)15-5-7-16(28)8-6-15)31(36(2,33)34)17-9-10-20(27)21(29)11-17/h5-14H,3-4H2,1-2H3,(H,30,32) |
| InChIKey | JTDBWQUGKLZVII-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|