C39H39BF2N2O7S — CID 67352773
5-cyclopropyl-2-[4-(4-fluorophenoxy)phenyl]-6-[2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylsulfonylamino]-N-methyl-1-benzofuran-3-carboxamide (PubChem CID 67352773) has the molecular formula C39H39BF2N2O7S and a molecular weight of 728.62 g/mol. Its IUPAC name is 5-cyclopropyl-2-[4-(4-fluorophenoxy)phenyl]-6-[2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylsulfonylamino]-N-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 5-cyclopropyl-2-[4-(4-fluorophenoxy)phenyl]-6-[2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylsulfonylamino]-N-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 67352773 |
| Molecular Formula | C39H39BF2N2O7S |
| Molecular Weight | 728.62 g/mol |
| Exact Mass | 728.25 |
| IUPAC Name | 5-cyclopropyl-2-[4-(4-fluorophenoxy)phenyl]-6-[2-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethylsulfonylamino]-N-methyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(Oc3ccc(F)cc3)cc2)oc2cc(NS(=O)(=O)CCc3ccc(B4OC(C)(C)C(C)(C)O4)c(F)c3)c(C3CC3)cc12 |
| InChI | InChI=1S/C39H39BF2N2O7S/c1-38(2)39(3,4)51-40(50-38)31-17-6-23(20-32(31)42)18-19-52(46,47)44-33-22-34-30(21-29(33)24-7-8-24)35(37(45)43-5)36(49-34)25-9-13-27(14-10-25)48-28-15-11-26(41)12-16-28/h6,9-17,20-22,24,44H,7-8,18-19H2,1-5H3,(H,43,45) |
| InChIKey | QSGHYDLBHOYCNU-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.62 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|