C35H37BF4N2O6S — CID 67354772
5-cyclopropyl-2-(4-fluorophenyl)-N-methyl-6-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]propylsulfonylamino]-1-benzofuran-3-carboxamide (PubChem CID 67354772) has the molecular formula C35H37BF4N2O6S and a molecular weight of 700.56 g/mol. Its IUPAC name is 5-cyclopropyl-2-(4-fluorophenyl)-N-methyl-6-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]propylsulfonylamino]-1-benzofuran-3-carboxamide.
| Compound Name | 5-cyclopropyl-2-(4-fluorophenyl)-N-methyl-6-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]propylsulfonylamino]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 67354772 |
| Molecular Formula | C35H37BF4N2O6S |
| Molecular Weight | 700.56 g/mol |
| Exact Mass | 700.24 |
| IUPAC Name | 5-cyclopropyl-2-(4-fluorophenyl)-N-methyl-6-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]propylsulfonylamino]-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(NS(=O)(=O)CCCc3ccc(B4OC(C)(C)C(C)(C)O4)cc3C(F)(F)F)c(C3CC3)cc12 |
| InChI | InChI=1S/C35H37BF4N2O6S/c1-33(2)34(3,4)48-36(47-33)23-13-10-21(27(17-23)35(38,39)40)7-6-16-49(44,45)42-28-19-29-26(18-25(28)20-8-9-20)30(32(43)41-5)31(46-29)22-11-14-24(37)15-12-22/h10-15,17-20,42H,6-9,16H2,1-5H3,(H,41,43) |
| InChIKey | HXTYPQHPQZDBLY-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.56 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|