C20H18FNO5S — CID 71742621
methyl 5-cyclopropyl-2-(4-fluorophenyl)-6-(methanesulfonamido)-1-benzofuran-3-carboxylate (PubChem CID 71742621) has the molecular formula C20H18FNO5S and a molecular weight of 403.43 g/mol. Its IUPAC name is methyl 5-cyclopropyl-2-(4-fluorophenyl)-6-(methanesulfonamido)-1-benzofuran-3-carboxylate.
| Compound Name | methyl 5-cyclopropyl-2-(4-fluorophenyl)-6-(methanesulfonamido)-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 71742621 |
| Molecular Formula | C20H18FNO5S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | methyl 5-cyclopropyl-2-(4-fluorophenyl)-6-(methanesulfonamido)-1-benzofuran-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)oc2cc(NS(C)(=O)=O)c(C3CC3)cc12 |
| InChI | InChI=1S/C20H18FNO5S/c1-26-20(23)18-15-9-14(11-3-4-11)16(22-28(2,24)25)10-17(15)27-19(18)12-5-7-13(21)8-6-12/h5-11,22H,3-4H2,1-2H3 |
| InChIKey | JAVXMDHQOOVUCK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |