C20H18FNO5S — CID 174716725
[5-cyclopropyl-2-(4-fluorophenyl)-6-(methanesulfonamido)-1-benzofuran-3-yl]methyl formate (PubChem CID 174716725) has the molecular formula C20H18FNO5S and a molecular weight of 403.43 g/mol. Its IUPAC name is [5-cyclopropyl-2-(4-fluorophenyl)-6-(methanesulfonamido)-1-benzofuran-3-yl]methyl formate.
| Compound Name | [5-cyclopropyl-2-(4-fluorophenyl)-6-(methanesulfonamido)-1-benzofuran-3-yl]methyl formate |
|---|---|
| PubChem CID | 174716725 |
| Molecular Formula | C20H18FNO5S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | [5-cyclopropyl-2-(4-fluorophenyl)-6-(methanesulfonamido)-1-benzofuran-3-yl]methyl formate |
| SMILES | CS(=O)(=O)Nc1cc2oc(-c3ccc(F)cc3)c(COC=O)c2cc1C1CC1 |
| InChI | InChI=1S/C20H18FNO5S/c1-28(24,25)22-18-9-19-16(8-15(18)12-2-3-12)17(10-26-11-23)20(27-19)13-4-6-14(21)7-5-13/h4-9,11-12,22H,2-3,10H2,1H3 |
| InChIKey | NUACCUUKLMGTFO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|