C26H21F2N3O6S — CID 71258761
5-cyclopropyl-6-[(3-fluoro-4-nitrophenyl)methylsulfonylamino]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide (PubChem CID 71258761) has the molecular formula C26H21F2N3O6S and a molecular weight of 541.53 g/mol. Its IUPAC name is 5-cyclopropyl-6-[(3-fluoro-4-nitrophenyl)methylsulfonylamino]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 5-cyclopropyl-6-[(3-fluoro-4-nitrophenyl)methylsulfonylamino]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 71258761 |
| Molecular Formula | C26H21F2N3O6S |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 5-cyclopropyl-6-[(3-fluoro-4-nitrophenyl)methylsulfonylamino]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(NS(=O)(=O)Cc3ccc([N+](=O)[O-])c(F)c3)c(C3CC3)cc12 |
| InChI | InChI=1S/C26H21F2N3O6S/c1-29-26(32)24-19-11-18(15-3-4-15)21(12-23(19)37-25(24)16-5-7-17(27)8-6-16)30-38(35,36)13-14-2-9-22(31(33)34)20(28)10-14/h2,5-12,15,30H,3-4,13H2,1H3,(H,29,32) |
| InChIKey | YOBBLIPXFCEOHS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|