C28H24FN3O8S — CID 71258739
5-cyclopropyl-2-(4-fluorophenyl)-6-[(3-methoxycarbonyl-4-nitro-N-sulfinoanilino)methyl]-3-(methylcarbamoyl)-1-benzofuran (PubChem CID 71258739) has the molecular formula C28H24FN3O8S and a molecular weight of 581.58 g/mol. Its IUPAC name is 5-cyclopropyl-2-(4-fluorophenyl)-6-[(3-methoxycarbonyl-4-nitro-N-sulfinoanilino)methyl]-3-(methylcarbamoyl)-1-benzofuran.
| Compound Name | 5-cyclopropyl-2-(4-fluorophenyl)-6-[(3-methoxycarbonyl-4-nitro-N-sulfinoanilino)methyl]-3-(methylcarbamoyl)-1-benzofuran |
|---|---|
| PubChem CID | 71258739 |
| Molecular Formula | C28H24FN3O8S |
| Molecular Weight | 581.58 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | 5-cyclopropyl-2-(4-fluorophenyl)-6-[(3-methoxycarbonyl-4-nitro-N-sulfinoanilino)methyl]-3-(methylcarbamoyl)-1-benzofuran |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(CN(c3ccc([N+](=O)[O-])c(C(=O)OC)c3)S(=O)O)c(C3CC3)cc12 |
| InChI | InChI=1S/C28H24FN3O8S/c1-30-27(33)25-22-13-20(15-3-4-15)17(11-24(22)40-26(25)16-5-7-18(29)8-6-16)14-31(41(37)38)19-9-10-23(32(35)36)21(12-19)28(34)39-2/h5-13,15H,3-4,14H2,1-2H3,(H,30,33)(H,37,38) |
| InChIKey | RKABCVXFXVDLCQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 152.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|