C35H39FN2O7S — CID 122573402
ethyl 4-[6-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]methylsulfonylamino]hexoxy]benzoate (PubChem CID 122573402) has the molecular formula C35H39FN2O7S and a molecular weight of 650.77 g/mol. Its IUPAC name is ethyl 4-[6-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]methylsulfonylamino]hexoxy]benzoate.
| Compound Name | ethyl 4-[6-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]methylsulfonylamino]hexoxy]benzoate |
|---|---|
| PubChem CID | 122573402 |
| Molecular Formula | C35H39FN2O7S |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | ethyl 4-[6-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]methylsulfonylamino]hexoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCCCCCCNS(=O)(=O)Cc2cc3oc(-c4ccc(F)cc4)c(C(=O)NC)c3cc2C2CC2)cc1 |
| InChI | InChI=1S/C35H39FN2O7S/c1-3-43-35(40)25-12-16-28(17-13-25)44-19-7-5-4-6-18-38-46(41,42)22-26-20-31-30(21-29(26)23-8-9-23)32(34(39)37-2)33(45-31)24-10-14-27(36)15-11-24/h10-17,20-21,23,38H,3-9,18-19,22H2,1-2H3,(H,37,39) |
| InChIKey | WDHOIJIDINVLHU-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|