C30H37FN2O5S — CID 139322909
5-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfanylamino]pentoxy]pentanoic acid (PubChem CID 139322909) has the molecular formula C30H37FN2O5S and a molecular weight of 556.70 g/mol. Its IUPAC name is 5-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfanylamino]pentoxy]pentanoic acid.
| Compound Name | 5-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfanylamino]pentoxy]pentanoic acid |
|---|---|
| PubChem CID | 139322909 |
| Molecular Formula | C30H37FN2O5S |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 5-[5-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfanylamino]pentoxy]pentanoic acid |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(CCCCCOCCCCC(=O)O)SC)c(C3CC3)cc12 |
| InChI | InChI=1S/C30H37FN2O5S/c1-32-30(36)28-24-18-23(20-9-10-20)25(19-26(24)38-29(28)21-11-13-22(31)14-12-21)33(39-2)15-5-3-6-16-37-17-7-4-8-27(34)35/h11-14,18-20H,3-10,15-17H2,1-2H3,(H,32,36)(H,34,35) |
| InChIKey | FWNIEVBXNHSLFV-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|