C35H35FN2O10S — CID 154491320
4-[4-[2-[2-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfonylamino]ethoxy]ethoxymethyl]phenyl]-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 154491320) has the molecular formula C35H35FN2O10S and a molecular weight of 694.73 g/mol. Its IUPAC name is 4-[4-[2-[2-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfonylamino]ethoxy]ethoxymethyl]phenyl]-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | 4-[4-[2-[2-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfonylamino]ethoxy]ethoxymethyl]phenyl]-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 154491320 |
| Molecular Formula | C35H35FN2O10S |
| Molecular Weight | 694.73 g/mol |
| Exact Mass | 694.20 |
| IUPAC Name | 4-[4-[2-[2-[[5-cyclopropyl-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]-methylsulfonylamino]ethoxy]ethoxymethyl]phenyl]-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(CCOCCOCc3ccc(C(O)=CC(=O)C(=O)O)cc3)S(C)(=O)=O)c(C3CC3)cc12 |
| InChI | InChI=1S/C35H35FN2O10S/c1-37-34(41)32-27-17-26(22-7-8-22)28(18-31(27)48-33(32)24-9-11-25(36)12-10-24)38(49(2,44)45)13-14-46-15-16-47-20-21-3-5-23(6-4-21)29(39)19-30(40)35(42)43/h3-6,9-12,17-19,22,39H,7-8,13-16,20H2,1-2H3,(H,37,41)(H,42,43) |
| InChIKey | HDOOZSXDKDSEPN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 172.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.73 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|