C30H36FN3O11S — CID 175117014
[5-cyclopropyl-2-(4-fluorophenyl)-6-[2-[2-[2-[1-(hydroxyamino)-2-methyl-1-oxopropan-2-yl]oxyethoxy]ethoxy]ethyl-methylsulfonylamino]-1-benzofuran-3-carbonyl]carbamic acid (PubChem CID 175117014) has the molecular formula C30H36FN3O11S and a molecular weight of 665.69 g/mol. Its IUPAC name is [5-cyclopropyl-2-(4-fluorophenyl)-6-[2-[2-[2-[1-(hydroxyamino)-2-methyl-1-oxopropan-2-yl]oxyethoxy]ethoxy]ethyl-methylsulfonylamino]-1-benzofuran-3-carbonyl]carbamic acid.
| Compound Name | [5-cyclopropyl-2-(4-fluorophenyl)-6-[2-[2-[2-[1-(hydroxyamino)-2-methyl-1-oxopropan-2-yl]oxyethoxy]ethoxy]ethyl-methylsulfonylamino]-1-benzofuran-3-carbonyl]carbamic acid |
|---|---|
| PubChem CID | 175117014 |
| Molecular Formula | C30H36FN3O11S |
| Molecular Weight | 665.69 g/mol |
| Exact Mass | 665.21 |
| IUPAC Name | [5-cyclopropyl-2-(4-fluorophenyl)-6-[2-[2-[2-[1-(hydroxyamino)-2-methyl-1-oxopropan-2-yl]oxyethoxy]ethoxy]ethyl-methylsulfonylamino]-1-benzofuran-3-carbonyl]carbamic acid |
| SMILES | CC(C)(OCCOCCOCCN(c1cc2oc(-c3ccc(F)cc3)c(C(=O)NC(=O)O)c2cc1C1CC1)S(C)(=O)=O)C(=O)NO |
| InChI | InChI=1S/C30H36FN3O11S/c1-30(2,28(36)33-39)44-15-14-43-13-12-42-11-10-34(46(3,40)41)23-17-24-22(16-21(23)18-4-5-18)25(27(35)32-29(37)38)26(45-24)19-6-8-20(31)9-7-19/h6-9,16-18,39H,4-5,10-15H2,1-3H3,(H,32,35)(H,33,36)(H,37,38) |
| InChIKey | XEAHGSZLZFQGDT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 193.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.69 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|