C32H24FN3O2 — CID 59275233
5-[3-(2-benzylpyrazol-3-yl)phenyl]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide (PubChem CID 59275233) has the molecular formula C32H24FN3O2 and a molecular weight of 501.56 g/mol. Its IUPAC name is 5-[3-(2-benzylpyrazol-3-yl)phenyl]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 5-[3-(2-benzylpyrazol-3-yl)phenyl]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 59275233 |
| Molecular Formula | C32H24FN3O2 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 5-[3-(2-benzylpyrazol-3-yl)phenyl]-2-(4-fluorophenyl)-N-methyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2ccc(-c3cccc(-c4ccnn4Cc4ccccc4)c3)cc12 |
| InChI | InChI=1S/C32H24FN3O2/c1-34-32(37)30-27-19-24(12-15-29(27)38-31(30)22-10-13-26(33)14-11-22)23-8-5-9-25(18-23)28-16-17-35-36(28)20-21-6-3-2-4-7-21/h2-19H,20H2,1H3,(H,34,37) |
| InChIKey | JNSWYMIHZYWWRW-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |