C19H18FNO3 — CID 118682835
6-ethoxy-2-(4-fluorophenyl)-N,5-dimethyl-1-benzofuran-3-carboxamide (PubChem CID 118682835) has the molecular formula C19H18FNO3 and a molecular weight of 327.36 g/mol. Its IUPAC name is 6-ethoxy-2-(4-fluorophenyl)-N,5-dimethyl-1-benzofuran-3-carboxamide.
| Compound Name | 6-ethoxy-2-(4-fluorophenyl)-N,5-dimethyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 118682835 |
| Molecular Formula | C19H18FNO3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 6-ethoxy-2-(4-fluorophenyl)-N,5-dimethyl-1-benzofuran-3-carboxamide |
| SMILES | CCOc1cc2oc(-c3ccc(F)cc3)c(C(=O)NC)c2cc1C |
| InChI | InChI=1S/C19H18FNO3/c1-4-23-15-10-16-14(9-11(15)2)17(19(22)21-3)18(24-16)12-5-7-13(20)8-6-12/h5-10H,4H2,1-3H3,(H,21,22) |
| InChIKey | YKBVTQDKFBVTIU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |