C21H22FNO4 — CID 142773431
6-(diethylamino)-5-ethoxy-2-(4-fluorophenyl)-1-benzofuran-3-carboxylic acid (PubChem CID 142773431) has the molecular formula C21H22FNO4 and a molecular weight of 371.41 g/mol. Its IUPAC name is 6-(diethylamino)-5-ethoxy-2-(4-fluorophenyl)-1-benzofuran-3-carboxylic acid.
| Compound Name | 6-(diethylamino)-5-ethoxy-2-(4-fluorophenyl)-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 142773431 |
| Molecular Formula | C21H22FNO4 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 6-(diethylamino)-5-ethoxy-2-(4-fluorophenyl)-1-benzofuran-3-carboxylic acid |
| SMILES | CCOc1cc2c(C(=O)O)c(-c3ccc(F)cc3)oc2cc1N(CC)CC |
| InChI | InChI=1S/C21H22FNO4/c1-4-23(5-2)16-12-17-15(11-18(16)26-6-3)19(21(24)25)20(27-17)13-7-9-14(22)10-8-13/h7-12H,4-6H2,1-3H3,(H,24,25) |
| InChIKey | CNTOBYGRKZMQKL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |