C19H13FN2O4 — CID 142773481
2-(4-fluorophenyl)-6-(1H-imidazol-2-yl)-5-methoxy-1-benzofuran-3-carboxylic acid (PubChem CID 142773481) has the molecular formula C19H13FN2O4 and a molecular weight of 352.32 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6-(1H-imidazol-2-yl)-5-methoxy-1-benzofuran-3-carboxylic acid.
| Compound Name | 2-(4-fluorophenyl)-6-(1H-imidazol-2-yl)-5-methoxy-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 142773481 |
| Molecular Formula | C19H13FN2O4 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-(4-fluorophenyl)-6-(1H-imidazol-2-yl)-5-methoxy-1-benzofuran-3-carboxylic acid |
| SMILES | COc1cc2c(C(=O)O)c(-c3ccc(F)cc3)oc2cc1-c1ncc[nH]1 |
| InChI | InChI=1S/C19H13FN2O4/c1-25-14-8-12-15(9-13(14)18-21-6-7-22-18)26-17(16(12)19(23)24)10-2-4-11(20)5-3-10/h2-9H,1H3,(H,21,22)(H,23,24) |
| InChIKey | IBQSYQJUWJACPJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |