C20H17FO5 — CID 149158318
6-acetyl-2-(4-fluorophenyl)-5-propan-2-yloxy-1-benzofuran-3-carboxylic acid (PubChem CID 149158318) has the molecular formula C20H17FO5 and a molecular weight of 356.35 g/mol. Its IUPAC name is 6-acetyl-2-(4-fluorophenyl)-5-propan-2-yloxy-1-benzofuran-3-carboxylic acid.
| Compound Name | 6-acetyl-2-(4-fluorophenyl)-5-propan-2-yloxy-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 149158318 |
| Molecular Formula | C20H17FO5 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 6-acetyl-2-(4-fluorophenyl)-5-propan-2-yloxy-1-benzofuran-3-carboxylic acid |
| SMILES | CC(=O)c1cc2oc(-c3ccc(F)cc3)c(C(=O)O)c2cc1OC(C)C |
| InChI | InChI=1S/C20H17FO5/c1-10(2)25-16-9-15-17(8-14(16)11(3)22)26-19(18(15)20(23)24)12-4-6-13(21)7-5-12/h4-10H,1-3H3,(H,23,24) |
| InChIKey | FRAZHJQZVPEIHW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |