C21H20FNO5 — CID 68683187
ethyl 6-carbamoyl-2-(4-fluorophenyl)-5-propan-2-yloxy-1-benzofuran-3-carboxylate (PubChem CID 68683187) has the molecular formula C21H20FNO5 and a molecular weight of 385.39 g/mol. Its IUPAC name is ethyl 6-carbamoyl-2-(4-fluorophenyl)-5-propan-2-yloxy-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 6-carbamoyl-2-(4-fluorophenyl)-5-propan-2-yloxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 68683187 |
| Molecular Formula | C21H20FNO5 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | ethyl 6-carbamoyl-2-(4-fluorophenyl)-5-propan-2-yloxy-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)oc2cc(C(N)=O)c(OC(C)C)cc12 |
| InChI | InChI=1S/C21H20FNO5/c1-4-26-21(25)18-14-9-17(27-11(2)3)15(20(23)24)10-16(14)28-19(18)12-5-7-13(22)8-6-12/h5-11H,4H2,1-3H3,(H2,23,24) |
| InChIKey | SOIWAYQFRVXONC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |