C23H21FN2O7 — CID 91420471
carbamoyl 2-(4-fluorophenyl)-6-(5-methyl-2-oxo-1,3-oxazolidin-5-yl)-5-propan-2-yloxy-1-benzofuran-3-carboxylate (PubChem CID 91420471) has the molecular formula C23H21FN2O7 and a molecular weight of 456.43 g/mol. Its IUPAC name is carbamoyl 2-(4-fluorophenyl)-6-(5-methyl-2-oxo-1,3-oxazolidin-5-yl)-5-propan-2-yloxy-1-benzofuran-3-carboxylate.
| Compound Name | carbamoyl 2-(4-fluorophenyl)-6-(5-methyl-2-oxo-1,3-oxazolidin-5-yl)-5-propan-2-yloxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 91420471 |
| Molecular Formula | C23H21FN2O7 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | carbamoyl 2-(4-fluorophenyl)-6-(5-methyl-2-oxo-1,3-oxazolidin-5-yl)-5-propan-2-yloxy-1-benzofuran-3-carboxylate |
| SMILES | CC(C)Oc1cc2c(C(=O)OC(N)=O)c(-c3ccc(F)cc3)oc2cc1C1(C)CNC(=O)O1 |
| InChI | InChI=1S/C23H21FN2O7/c1-11(2)30-17-8-14-16(9-15(17)23(3)10-26-22(29)33-23)31-19(12-4-6-13(24)7-5-12)18(14)20(27)32-21(25)28/h4-9,11H,10H2,1-3H3,(H2,25,28)(H,26,29) |
| InChIKey | BDEQTKWPKADXDS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|