C19H17FN2O5 — CID 91616778
carbamoyl 6-(dimethylamino)-2-(4-fluorophenyl)-5-methoxy-1-benzofuran-3-carboxylate (PubChem CID 91616778) has the molecular formula C19H17FN2O5 and a molecular weight of 372.35 g/mol. Its IUPAC name is carbamoyl 6-(dimethylamino)-2-(4-fluorophenyl)-5-methoxy-1-benzofuran-3-carboxylate.
| Compound Name | carbamoyl 6-(dimethylamino)-2-(4-fluorophenyl)-5-methoxy-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 91616778 |
| Molecular Formula | C19H17FN2O5 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | carbamoyl 6-(dimethylamino)-2-(4-fluorophenyl)-5-methoxy-1-benzofuran-3-carboxylate |
| SMILES | COc1cc2c(C(=O)OC(N)=O)c(-c3ccc(F)cc3)oc2cc1N(C)C |
| InChI | InChI=1S/C19H17FN2O5/c1-22(2)13-9-14-12(8-15(13)25-3)16(18(23)27-19(21)24)17(26-14)10-4-6-11(20)7-5-10/h4-9H,1-3H3,(H2,21,24) |
| InChIKey | NLARMVNKVFRASN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|